C10H14F6 — CID 59204144
1-(1,1,2,2,4,4-hexafluorobutyl)-1-methylcyclopentane (PubChem CID 59204144) has the molecular formula C10H14F6 and a molecular weight of 248.21 g/mol. Its IUPAC name is 1-(1,1,2,2,4,4-hexafluorobutyl)-1-methylcyclopentane.
| Compound Name | 1-(1,1,2,2,4,4-hexafluorobutyl)-1-methylcyclopentane |
|---|---|
| PubChem CID | 59204144 |
| Molecular Formula | C10H14F6 |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-(1,1,2,2,4,4-hexafluorobutyl)-1-methylcyclopentane |
| SMILES | CC1(C(F)(F)C(F)(F)CC(F)F)CCCC1 |
| InChI | InChI=1S/C10H14F6/c1-8(4-2-3-5-8)10(15,16)9(13,14)6-7(11)12/h7H,2-6H2,1H3 |
| InChIKey | CMIKZWVAMUKZAF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|