C22H36OS — CID 59205481
(3R,4R)-5,6-ditert-butyl-2,2,3-trimethyl-4-phenylsulfanyloxane (PubChem CID 59205481) has the molecular formula C22H36OS and a molecular weight of 348.60 g/mol. Its IUPAC name is (3R,4R)-5,6-ditert-butyl-2,2,3-trimethyl-4-phenylsulfanyloxane.
| Compound Name | (3R,4R)-5,6-ditert-butyl-2,2,3-trimethyl-4-phenylsulfanyloxane |
|---|---|
| PubChem CID | 59205481 |
| Molecular Formula | C22H36OS |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (3R,4R)-5,6-ditert-butyl-2,2,3-trimethyl-4-phenylsulfanyloxane |
| SMILES | C[C@H]1[C@H](Sc2ccccc2)C(C(C)(C)C)C(C(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C22H36OS/c1-15-18(24-16-13-11-10-12-14-16)17(20(2,3)4)19(21(5,6)7)23-22(15,8)9/h10-15,17-19H,1-9H3/t15-,17?,18-,19?/m0/s1 |
| InChIKey | XHMWICMBBIAOIY-BARLLCKDSA-N |
| XLogP | 6.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |