C29H22ClNO5 — CID 59205851
5'-chlorospiro[2-benzofuran-3,14'-3,7-dioxa-21-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(25),2(15),4(13),5,11,16-hexaene]-1,8'-dione (PubChem CID 59205851) has the molecular formula C29H22ClNO5 and a molecular weight of 499.95 g/mol. Its IUPAC name is 5'-chlorospiro[2-benzofuran-3,14'-3,7-dioxa-21-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(25),2(15),4(13),5,11,16-hexaene]-1,8'-dione.
| Compound Name | 5'-chlorospiro[2-benzofuran-3,14'-3,7-dioxa-21-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(25),2(15),4(13),5,11,16-hexaene]-1,8'-dione |
|---|---|
| PubChem CID | 59205851 |
| Molecular Formula | C29H22ClNO5 |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 5'-chlorospiro[2-benzofuran-3,14'-3,7-dioxa-21-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(25),2(15),4(13),5,11,16-hexaene]-1,8'-dione |
| SMILES | O=C1CCc2cc3c(c(Cl)c2O1)Oc1c(cc2c4c1CCCN4CCC2)C31OC(=O)c2ccccc21 |
| InChI | InChI=1S/C29H22ClNO5/c30-23-25-16(9-10-22(32)34-25)14-21-27(23)35-26-18-7-4-12-31-11-3-5-15(24(18)31)13-20(26)29(21)19-8-2-1-6-17(19)28(33)36-29/h1-2,6,8,13-14H,3-5,7,9-12H2 |
| InChIKey | CMNLRLVKUXPLQQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|