C32H35N3O5 — CID 59207036
4-[5-[[1-(1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-2-methylphenyl]-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 59207036) has the molecular formula C32H35N3O5 and a molecular weight of 541.65 g/mol. Its IUPAC name is 4-[5-[[1-(1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-2-methylphenyl]-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 4-[5-[[1-(1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-2-methylphenyl]-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 59207036 |
| Molecular Formula | C32H35N3O5 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 4-[5-[[1-(1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-2-methylphenyl]-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | Cc1ccc(NC(=O)C2(c3ccc4c(c3)OCO4)CC2)cc1-c1ccc(C(=O)NCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C32H35N3O5/c1-22-3-9-26(34-31(37)32(11-12-32)25-8-10-28-29(19-25)40-21-39-28)20-27(22)23-4-6-24(7-5-23)30(36)33-13-2-14-35-15-17-38-18-16-35/h3-10,19-20H,2,11-18,21H2,1H3,(H,33,36)(H,34,37) |
| InChIKey | HZFCMERUXXDGTH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|