C22H41BO3SSi — CID 59207290
tert-butyl-dimethyl-[6-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]hexoxy]silane (PubChem CID 59207290) has the molecular formula C22H41BO3SSi and a molecular weight of 424.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[6-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]hexoxy]silane.
| Compound Name | tert-butyl-dimethyl-[6-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]hexoxy]silane |
|---|---|
| PubChem CID | 59207290 |
| Molecular Formula | C22H41BO3SSi |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | tert-butyl-dimethyl-[6-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]hexoxy]silane |
| SMILES | CC1(C)OB(c2ccc(CCCCCCO[Si](C)(C)C(C)(C)C)s2)OC1(C)C |
| InChI | InChI=1S/C22H41BO3SSi/c1-20(2,3)28(8,9)24-17-13-11-10-12-14-18-15-16-19(27-18)23-25-21(4,5)22(6,7)26-23/h15-16H,10-14,17H2,1-9H3 |
| InChIKey | USJSDHASHSABMN-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|