C40H42O4S2 — CID 59207325
penta-1,4-dien-3-yl 5-[4-[5-[5-[4-(5-oxo-5-penta-1,4-dien-3-yloxypentyl)phenyl]thiophen-2-yl]thiophen-2-yl]phenyl]pentanoate (PubChem CID 59207325) has the molecular formula C40H42O4S2 and a molecular weight of 650.91 g/mol. Its IUPAC name is penta-1,4-dien-3-yl 5-[4-[5-[5-[4-(5-oxo-5-penta-1,4-dien-3-yloxypentyl)phenyl]thiophen-2-yl]thiophen-2-yl]phenyl]pentanoate.
| Compound Name | penta-1,4-dien-3-yl 5-[4-[5-[5-[4-(5-oxo-5-penta-1,4-dien-3-yloxypentyl)phenyl]thiophen-2-yl]thiophen-2-yl]phenyl]pentanoate |
|---|---|
| PubChem CID | 59207325 |
| Molecular Formula | C40H42O4S2 |
| Molecular Weight | 650.91 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | penta-1,4-dien-3-yl 5-[4-[5-[5-[4-(5-oxo-5-penta-1,4-dien-3-yloxypentyl)phenyl]thiophen-2-yl]thiophen-2-yl]phenyl]pentanoate |
| SMILES | C=CC(C=C)OC(=O)CCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(CCCCC(=O)OC(C=C)C=C)cc4)s3)s2)cc1 |
| InChI | InChI=1S/C40H42O4S2/c1-5-33(6-2)43-39(41)15-11-9-13-29-17-21-31(22-18-29)35-25-27-37(45-35)38-28-26-36(46-38)32-23-19-30(20-24-32)14-10-12-16-40(42)44-34(7-3)8-4/h5-8,17-28,33-34H,1-4,9-16H2 |
| InChIKey | OUTFVSOPKRSMCN-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.91 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|