C32H36N12O5S2 — CID 59207355
2-[[2-[4-cyano-3-[[4-(3-methoxypropylamino)-6-(methylamino)-2-(2,4,6-trimethylanilino)pyrimidin-5-yl]diazenyl]pyrazol-1-yl]-1,3-benzothiazol-5-yl]sulfonylamino]propanoic acid (PubChem CID 59207355) has the molecular formula C32H36N12O5S2 and a molecular weight of 732.85 g/mol. Its IUPAC name is 2-[[2-[4-cyano-3-[[4-(3-methoxypropylamino)-6-(methylamino)-2-(2,4,6-trimethylanilino)pyrimidin-5-yl]diazenyl]pyrazol-1-yl]-1,3-benzothiazol-5-yl]sulfonylamino]propanoic acid.
| Compound Name | 2-[[2-[4-cyano-3-[[4-(3-methoxypropylamino)-6-(methylamino)-2-(2,4,6-trimethylanilino)pyrimidin-5-yl]diazenyl]pyrazol-1-yl]-1,3-benzothiazol-5-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 59207355 |
| Molecular Formula | C32H36N12O5S2 |
| Molecular Weight | 732.85 g/mol |
| Exact Mass | 732.24 |
| IUPAC Name | 2-[[2-[4-cyano-3-[[4-(3-methoxypropylamino)-6-(methylamino)-2-(2,4,6-trimethylanilino)pyrimidin-5-yl]diazenyl]pyrazol-1-yl]-1,3-benzothiazol-5-yl]sulfonylamino]propanoic acid |
| SMILES | CNc1nc(Nc2c(C)cc(C)cc2C)nc(NCCCOC)c1/N=N/c1nn(-c2nc3cc(S(=O)(=O)NC(C)C(=O)O)ccc3s2)cc1C#N |
| InChI | InChI=1S/C32H36N12O5S2/c1-17-12-18(2)25(19(3)13-17)37-31-38-28(34-5)26(29(39-31)35-10-7-11-49-6)40-41-27-21(15-33)16-44(42-27)32-36-23-14-22(8-9-24(23)50-32)51(47,48)43-20(4)30(45)46/h8-9,12-14,16,20,43H,7,10-11H2,1-6H3,(H,45,46)(H3,34,35,37,38,39)/b41-40+ |
| InChIKey | SDELHRFLRMXKRW-CDJCAARLSA-N |
| XLogP | 5.47 |
| TPSA | 233.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.85 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|