C36H43N11O4S — CID 59207423
3-[2-[3-[[2,4-bis(3-methoxypropylamino)-6-(2,4,6-trimethylanilino)pyrimidin-5-yl]diazenyl]-4-cyanopyrazol-1-yl]-1,3-benzothiazol-6-yl]butanoic acid (PubChem CID 59207423) has the molecular formula C36H43N11O4S and a molecular weight of 725.88 g/mol. Its IUPAC name is 3-[2-[3-[[2,4-bis(3-methoxypropylamino)-6-(2,4,6-trimethylanilino)pyrimidin-5-yl]diazenyl]-4-cyanopyrazol-1-yl]-1,3-benzothiazol-6-yl]butanoic acid.
| Compound Name | 3-[2-[3-[[2,4-bis(3-methoxypropylamino)-6-(2,4,6-trimethylanilino)pyrimidin-5-yl]diazenyl]-4-cyanopyrazol-1-yl]-1,3-benzothiazol-6-yl]butanoic acid |
|---|---|
| PubChem CID | 59207423 |
| Molecular Formula | C36H43N11O4S |
| Molecular Weight | 725.88 g/mol |
| Exact Mass | 725.32 |
| IUPAC Name | 3-[2-[3-[[2,4-bis(3-methoxypropylamino)-6-(2,4,6-trimethylanilino)pyrimidin-5-yl]diazenyl]-4-cyanopyrazol-1-yl]-1,3-benzothiazol-6-yl]butanoic acid |
| SMILES | COCCCNc1nc(NCCCOC)c(/N=N/c2nn(-c3nc4ccc(C(C)CC(=O)O)cc4s3)cc2C#N)c(Nc2c(C)cc(C)cc2C)n1 |
| InChI | InChI=1S/C36H43N11O4S/c1-21-15-23(3)30(24(4)16-21)41-34-31(33(38-11-7-13-50-5)42-35(43-34)39-12-8-14-51-6)44-45-32-26(19-37)20-47(46-32)36-40-27-10-9-25(18-28(27)52-36)22(2)17-29(48)49/h9-10,15-16,18,20,22H,7-8,11-14,17H2,1-6H3,(H,48,49)(H3,38,39,41,42,43)/b45-44+ |
| InChIKey | ACNPSAWCXCWCJY-JQOKOOLQSA-N |
| XLogP | 7.70 |
| TPSA | 196.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.88 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|