C36H23N13S3 — CID 59207512
3-[[4-(1,3-benzothiazol-2-yl)-2-[bis(1,3-benzothiazol-2-yl)amino]-6-(ethylamino)pyrimidin-5-yl]diazenyl]-1-pyridin-2-ylpyrazole-4-carbonitrile (PubChem CID 59207512) has the molecular formula C36H23N13S3 and a molecular weight of 733.87 g/mol. Its IUPAC name is 3-[[4-(1,3-benzothiazol-2-yl)-2-[bis(1,3-benzothiazol-2-yl)amino]-6-(ethylamino)pyrimidin-5-yl]diazenyl]-1-pyridin-2-ylpyrazole-4-carbonitrile.
| Compound Name | 3-[[4-(1,3-benzothiazol-2-yl)-2-[bis(1,3-benzothiazol-2-yl)amino]-6-(ethylamino)pyrimidin-5-yl]diazenyl]-1-pyridin-2-ylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 59207512 |
| Molecular Formula | C36H23N13S3 |
| Molecular Weight | 733.87 g/mol |
| Exact Mass | 733.14 |
| IUPAC Name | 3-[[4-(1,3-benzothiazol-2-yl)-2-[bis(1,3-benzothiazol-2-yl)amino]-6-(ethylamino)pyrimidin-5-yl]diazenyl]-1-pyridin-2-ylpyrazole-4-carbonitrile |
| SMILES | CCNc1nc(N(c2nc3ccccc3s2)c2nc3ccccc3s2)nc(-c2nc3ccccc3s2)c1/N=N/c1nn(-c2ccccn2)cc1C#N |
| InChI | InChI=1S/C36H23N13S3/c1-2-38-32-29(45-46-31-21(19-37)20-48(47-31)28-17-9-10-18-39-28)30(33-40-22-11-3-6-14-25(22)50-33)43-34(44-32)49(35-41-23-12-4-7-15-26(23)51-35)36-42-24-13-5-8-16-27(24)52-36/h3-18,20H,2H2,1H3,(H,38,43,44)/b46-45+ |
| InChIKey | RUBCOVPSOIMCCA-XVIFHXHVSA-N |
| XLogP | 9.74 |
| TPSA | 158.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.87 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|