C23H37N4O8S+ — CID 59207756
3-[3-[N-[3-(2,3-dihydroxypropoxy)-2-hydroxypropyl]-3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]-2-hydroxypropoxy]propane-1,2-diol (PubChem CID 59207756) has the molecular formula C23H37N4O8S+ and a molecular weight of 529.64 g/mol. Its IUPAC name is 3-[3-[N-[3-(2,3-dihydroxypropoxy)-2-hydroxypropyl]-3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]-2-hydroxypropoxy]propane-1,2-diol.
| Compound Name | 3-[3-[N-[3-(2,3-dihydroxypropoxy)-2-hydroxypropyl]-3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]-2-hydroxypropoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 59207756 |
| Molecular Formula | C23H37N4O8S+ |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 3-[3-[N-[3-(2,3-dihydroxypropoxy)-2-hydroxypropyl]-3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]-2-hydroxypropoxy]propane-1,2-diol |
| SMILES | Cc1cc(N(CC(O)COCC(O)CO)CC(O)COCC(O)CO)ccc1/N=N/c1scc[n+]1C |
| InChI | InChI=1S/C23H37N4O8S/c1-16-7-17(3-4-22(16)24-25-23-26(2)5-6-36-23)27(8-18(30)12-34-14-20(32)10-28)9-19(31)13-35-15-21(33)11-29/h3-7,18-21,28-33H,8-15H2,1-2H3/q+1 |
| InChIKey | ATAWESFKIWTRLB-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|