About N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline
N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline (PubChem CID 59207781) has the molecular formula C20H23N4S+
and a molecular weight of 351.50 g/mol. Its IUPAC name is N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline.
Molecular Properties
| Compound Name | N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline |
| PubChem CID | 59207781 |
| Molecular Formula | C20H23N4S+ |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline |
| SMILES | CC[n+]1ccsc1/N=N/c1ccc(N(C)Cc2ccccc2)cc1C |
| InChI | InChI=1S/C20H23N4S/c1-4-24-12-13-25-20(24)22-21-19-11-10-18(14-16(19)2)23(3)15-17-8-6-5-7-9-17/h5-14H,4,15H2,1-3H3/q+1 |
| InChIKey | VUFJELZLVWNUKJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline?
The IUPAC name of N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline (CID 59207781) is N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline.
What is the SMILES notation for N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline?
The canonical SMILES for N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline is CC[n+]1ccsc1/N=N/c1ccc(N(C)Cc2ccccc2)cc1C.
What is the InChIKey of N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline?
The InChIKey is VUFJELZLVWNUKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N4S/c1-4-24-12-13-25-20(24)22-21-19-11-10-18(14-16(19)2)23(3)15-17-8-6-5-7-9-17/h5-14H,4,15H2,1-3H3/q+1.
What are the key properties of N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline?
N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline has a molecular weight of 351.50 g/mol, XLogP of 5.42, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N,3-dimethylaniline is sourced from PubChem (CID 59207781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).