C27H45N4O9S+ — CID 59207801
3-[2-[2-[N-[2-[2-[2-(2,3-dihydroxypropoxy)ethoxy]ethoxy]ethyl]-3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethoxy]ethoxy]propane-1,2-diol (PubChem CID 59207801) has the molecular formula C27H45N4O9S+ and a molecular weight of 601.74 g/mol. Its IUPAC name is 3-[2-[2-[N-[2-[2-[2-(2,3-dihydroxypropoxy)ethoxy]ethoxy]ethyl]-3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethoxy]ethoxy]propane-1,2-diol.
| Compound Name | 3-[2-[2-[N-[2-[2-[2-(2,3-dihydroxypropoxy)ethoxy]ethoxy]ethyl]-3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethoxy]ethoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 59207801 |
| Molecular Formula | C27H45N4O9S+ |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | 3-[2-[2-[N-[2-[2-[2-(2,3-dihydroxypropoxy)ethoxy]ethoxy]ethyl]-3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethoxy]ethoxy]propane-1,2-diol |
| SMILES | Cc1cc(N(CCOCCOCCOCC(O)CO)CCOCCOCC(O)CO)ccc1/N=N/c1scc[n+]1C |
| InChI | InChI=1S/C27H45N4O9S/c1-22-17-23(3-4-26(22)28-29-27-30(2)7-16-41-27)31(6-9-37-12-14-39-20-24(34)18-32)5-8-36-10-11-38-13-15-40-21-25(35)19-33/h3-4,7,16-17,24-25,32-35H,5-6,8-15,18-21H2,1-2H3/q+1 |
| InChIKey | SMJDMDWSDSRYTA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|