C19H23NO4 — CID 59207921
(Z)-7-[(2R)-2-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)-4-oxoazetidin-1-yl]hept-5-enoic acid (PubChem CID 59207921) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (Z)-7-[(2R)-2-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)-4-oxoazetidin-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2R)-2-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)-4-oxoazetidin-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 59207921 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (Z)-7-[(2R)-2-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)-4-oxoazetidin-1-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\CN1C(=O)C[C@@H]1c1ccc2c(c1)CCC2O |
| InChI | InChI=1S/C19H23NO4/c21-17-9-7-13-11-14(6-8-15(13)17)16-12-18(22)20(16)10-4-2-1-3-5-19(23)24/h2,4,6,8,11,16-17,21H,1,3,5,7,9-10,12H2,(H,23,24)/b4-2-/t16-,17?/m1/s1 |
| InChIKey | PRXCMANICDDYIP-AODVCJMUSA-N |
| XLogP | 2.75 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|