C27H26F2N8O2S — CID 59208021
3-[8-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-4-methyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 59208021) has the molecular formula C27H26F2N8O2S and a molecular weight of 564.62 g/mol. Its IUPAC name is 3-[8-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-4-methyl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-[8-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-4-methyl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 59208021 |
| Molecular Formula | C27H26F2N8O2S |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 3-[8-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-4-methyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2nccs2)cc1-c1nc(NCCN(C)C)nc2c1CNC(=O)N2c1c(F)cccc1F |
| InChI | InChI=1S/C27H26F2N8O2S/c1-15-7-8-16(24(38)35-26-31-10-12-40-26)13-17(15)21-18-14-32-27(39)37(22-19(28)5-4-6-20(22)29)23(18)34-25(33-21)30-9-11-36(2)3/h4-8,10,12-13H,9,11,14H2,1-3H3,(H,32,39)(H,30,33,34)(H,31,35,38) |
| InChIKey | KYYQFTUCFAPAFY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |