C28H26FN3O2S2 — CID 59208537
N-[2-(4-fluorophenyl)phenyl]-2-[1-[3-(furan-2-yl)propanethioyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 59208537) has the molecular formula C28H26FN3O2S2 and a molecular weight of 519.67 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)phenyl]-2-[1-[3-(furan-2-yl)propanethioyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)phenyl]-2-[1-[3-(furan-2-yl)propanethioyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59208537 |
| Molecular Formula | C28H26FN3O2S2 |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | N-[2-(4-fluorophenyl)phenyl]-2-[1-[3-(furan-2-yl)propanethioyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1ccc(F)cc1)c1csc(C2CCN(C(=S)CCc3ccco3)CC2)n1 |
| InChI | InChI=1S/C28H26FN3O2S2/c29-21-9-7-19(8-10-21)23-5-1-2-6-24(23)30-27(33)25-18-36-28(31-25)20-13-15-32(16-14-20)26(35)12-11-22-4-3-17-34-22/h1-10,17-18,20H,11-16H2,(H,30,33) |
| InChIKey | MLTBINADMARRBM-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|