C6H5N3O2 — CID 592097
1,5-dihydropyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 592097) has the molecular formula C6H5N3O2 and a molecular weight of 151.12 g/mol. Its IUPAC name is 1,5-dihydropyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 1,5-dihydropyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 592097 |
| Molecular Formula | C6H5N3O2 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 1,5-dihydropyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]ccc2[nH]1 |
| InChI | InChI=1S/C6H5N3O2/c10-5-4-3(1-2-7-4)8-6(11)9-5/h1-2,7H,(H2,8,9,10,11) |
| InChIKey | BSRITDQWGPSXPQ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |