About ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate
ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate (PubChem CID 59210364) has the molecular formula C13H18Cl2N4O2
and a molecular weight of 333.22 g/mol. Its IUPAC name is ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate |
| PubChem CID | 59210364 |
| Molecular Formula | C13H18Cl2N4O2 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate |
| SMILES | CCOC(=O)Cc1c(Cl)nc(Cl)nc1NC1CCNCC1 |
| InChI | InChI=1S/C13H18Cl2N4O2/c1-2-21-10(20)7-9-11(14)18-13(15)19-12(9)17-8-3-5-16-6-4-8/h8,16H,2-7H2,1H3,(H,17,18,19) |
| InChIKey | HVECWDBJMDTIPM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate?
The IUPAC name of ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate (CID 59210364) is ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate.
What is the SMILES notation for ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate?
The canonical SMILES for ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate is CCOC(=O)Cc1c(Cl)nc(Cl)nc1NC1CCNCC1.
What is the InChIKey of ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate?
The InChIKey is HVECWDBJMDTIPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Cl2N4O2/c1-2-21-10(20)7-9-11(14)18-13(15)19-12(9)17-8-3-5-16-6-4-8/h8,16H,2-7H2,1H3,(H,17,18,19).
What are the key properties of ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate?
ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate has a molecular weight of 333.22 g/mol, XLogP of 2.05, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2,4-dichloro-6-(piperidin-4-ylamino)pyrimidin-5-yl]acetate is sourced from PubChem (CID 59210364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).