C52H36N2O4 — CID 59211117
2-[10-(2-carboxyphenyl)-4-(N-[4-(N-phenylanilino)phenyl]anilino)anthracen-9-yl]benzoic acid (PubChem CID 59211117) has the molecular formula C52H36N2O4 and a molecular weight of 752.87 g/mol. Its IUPAC name is 2-[10-(2-carboxyphenyl)-4-(N-[4-(N-phenylanilino)phenyl]anilino)anthracen-9-yl]benzoic acid.
| Compound Name | 2-[10-(2-carboxyphenyl)-4-(N-[4-(N-phenylanilino)phenyl]anilino)anthracen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 59211117 |
| Molecular Formula | C52H36N2O4 |
| Molecular Weight | 752.87 g/mol |
| Exact Mass | 752.27 |
| IUPAC Name | 2-[10-(2-carboxyphenyl)-4-(N-[4-(N-phenylanilino)phenyl]anilino)anthracen-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2ccccc2c(-c2ccccc2C(=O)O)c2c(N(c3ccccc3)c3ccc(N(c4ccccc4)c4ccccc4)cc3)cccc12 |
| InChI | InChI=1S/C52H36N2O4/c55-51(56)44-27-14-12-25-42(44)48-40-23-10-11-24-41(40)49(43-26-13-15-28-45(43)52(57)58)50-46(48)29-16-30-47(50)54(37-21-8-3-9-22-37)39-33-31-38(32-34-39)53(35-17-4-1-5-18-35)36-19-6-2-7-20-36/h1-34H,(H,55,56)(H,57,58) |
| InChIKey | RFYDJJXFTSRTNK-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.87 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|