C66H42N6O2 — CID 59211129
N-[9,10-bis[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]anthracen-1-yl]-N,9-diphenylcarbazol-3-amine (PubChem CID 59211129) has the molecular formula C66H42N6O2 and a molecular weight of 951.10 g/mol. Its IUPAC name is N-[9,10-bis[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]anthracen-1-yl]-N,9-diphenylcarbazol-3-amine.
| Compound Name | N-[9,10-bis[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]anthracen-1-yl]-N,9-diphenylcarbazol-3-amine |
|---|---|
| PubChem CID | 59211129 |
| Molecular Formula | C66H42N6O2 |
| Molecular Weight | 951.10 g/mol |
| Exact Mass | 950.34 |
| IUPAC Name | N-[9,10-bis[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]anthracen-1-yl]-N,9-diphenylcarbazol-3-amine |
| SMILES | c1ccc(-c2nnc(-c3ccc(-c4c5ccccc5c(-c5ccc(-c6nnc(-c7ccccc7)o6)cc5)c5c(N(c6ccccc6)c6ccc7c(c6)c6ccccc6n7-c6ccccc6)cccc45)cc3)o2)cc1 |
| InChI | InChI=1S/C66H42N6O2/c1-5-18-45(19-6-1)63-67-69-65(73-63)47-36-32-43(33-37-47)60-53-27-13-14-28-54(53)61(44-34-38-48(39-35-44)66-70-68-64(74-66)46-20-7-2-8-21-46)62-55(60)29-17-31-59(62)71(49-22-9-3-10-23-49)51-40-41-58-56(42-51)52-26-15-16-30-57(52)72(58)50-24-11-4-12-25-50/h1-42H |
| InChIKey | ZEBAQHLJZNSFCJ-UHFFFAOYSA-N |
| XLogP | 17.33 |
| TPSA | 86.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.10 |
| LogP ≤ 5 | 17.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|