About 2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol
2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol (PubChem CID 59211315) has the molecular formula C27H33N3O2
and a molecular weight of 431.58 g/mol. Its IUPAC name is 2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol.
Molecular Properties
| Compound Name | 2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol |
| PubChem CID | 59211315 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol |
| SMILES | CCN(CC)c1ccc(C2c3ccc(N(C)C)cc3Oc3cc(N(C)C)ccc32)c(O)c1 |
| InChI | InChI=1S/C27H33N3O2/c1-7-30(8-2)20-11-12-21(24(31)15-20)27-22-13-9-18(28(3)4)16-25(22)32-26-17-19(29(5)6)10-14-23(26)27/h9-17,27,31H,7-8H2,1-6H3 |
| InChIKey | PKFOQQDCVXGKOG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol?
The IUPAC name of 2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol (CID 59211315) is 2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol.
What is the SMILES notation for 2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol?
The canonical SMILES for 2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol is CCN(CC)c1ccc(C2c3ccc(N(C)C)cc3Oc3cc(N(C)C)ccc32)c(O)c1.
What is the InChIKey of 2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol?
The InChIKey is PKFOQQDCVXGKOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33N3O2/c1-7-30(8-2)20-11-12-21(24(31)15-20)27-22-13-9-18(28(3)4)16-25(22)32-26-17-19(29(5)6)10-14-23(26)27/h9-17,27,31H,7-8H2,1-6H3.
What are the key properties of 2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol?
2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol has a molecular weight of 431.58 g/mol, XLogP of 5.66, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,6-bis(dimethylamino)-9H-xanthen-9-yl]-5-(diethylamino)phenol is sourced from PubChem (CID 59211315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).