C37H57N3O3S — CID 59211574
3-[(5Z)-2-tert-butyl-5-[(4,5-dimethoxythiophen-2-yl)methylidene]imidazol-4-yl]-4-methoxy-N,N-dioctylaniline (PubChem CID 59211574) has the molecular formula C37H57N3O3S and a molecular weight of 623.95 g/mol. Its IUPAC name is 3-[(5Z)-2-tert-butyl-5-[(4,5-dimethoxythiophen-2-yl)methylidene]imidazol-4-yl]-4-methoxy-N,N-dioctylaniline.
| Compound Name | 3-[(5Z)-2-tert-butyl-5-[(4,5-dimethoxythiophen-2-yl)methylidene]imidazol-4-yl]-4-methoxy-N,N-dioctylaniline |
|---|---|
| PubChem CID | 59211574 |
| Molecular Formula | C37H57N3O3S |
| Molecular Weight | 623.95 g/mol |
| Exact Mass | 623.41 |
| IUPAC Name | 3-[(5Z)-2-tert-butyl-5-[(4,5-dimethoxythiophen-2-yl)methylidene]imidazol-4-yl]-4-methoxy-N,N-dioctylaniline |
| SMILES | CCCCCCCCN(CCCCCCCC)c1ccc(OC)c(C2=NC(C(C)(C)C)=N/C2=C\c2cc(OC)c(OC)s2)c1 |
| InChI | InChI=1S/C37H57N3O3S/c1-9-11-13-15-17-19-23-40(24-20-18-16-14-12-10-2)28-21-22-32(41-6)30(25-28)34-31(38-36(39-34)37(3,4)5)26-29-27-33(42-7)35(43-8)44-29/h21-22,25-27H,9-20,23-24H2,1-8H3/b31-26- |
| InChIKey | BAZGFYQTISAJBH-ZXPTYKNPSA-N |
| XLogP | 10.59 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.95 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|