C8H8F10 — CID 59211715
1,1,2,2,3,3,5,5,6,6-decafluorooctane (PubChem CID 59211715) has the molecular formula C8H8F10 and a molecular weight of 294.13 g/mol. Its IUPAC name is 1,1,2,2,3,3,5,5,6,6-decafluorooctane.
| Compound Name | 1,1,2,2,3,3,5,5,6,6-decafluorooctane |
|---|---|
| PubChem CID | 59211715 |
| Molecular Formula | C8H8F10 |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 1,1,2,2,3,3,5,5,6,6-decafluorooctane |
| SMILES | CCC(F)(F)C(F)(F)CC(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H8F10/c1-2-5(11,12)6(13,14)3-7(15,16)8(17,18)4(9)10/h4H,2-3H2,1H3 |
| InChIKey | NRCIPRQFJCZERH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|