C8H11N3O3 — CID 59212246
6-nitro-2-propan-2-yl-2,3-dihydroimidazo[2,1-b][1,3]oxazole (PubChem CID 59212246) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 6-nitro-2-propan-2-yl-2,3-dihydroimidazo[2,1-b][1,3]oxazole.
| Compound Name | 6-nitro-2-propan-2-yl-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 59212246 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 6-nitro-2-propan-2-yl-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
| SMILES | CC(C)C1Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C8H11N3O3/c1-5(2)6-3-10-4-7(11(12)13)9-8(10)14-6/h4-6H,3H2,1-2H3 |
| InChIKey | SWEWXPHEOFYARI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|