C14H14F7NO3 — CID 592133
N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 592133) has the molecular formula C14H14F7NO3 and a molecular weight of 377.26 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 592133 |
| Molecular Formula | C14H14F7NO3 |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | COc1ccc(CCNC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C14H14F7NO3/c1-24-9-4-3-8(7-10(9)25-2)5-6-22-11(23)12(15,16)13(17,18)14(19,20)21/h3-4,7H,5-6H2,1-2H3,(H,22,23) |
| InChIKey | VLLJJJGOUHIKJE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|