About 4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine
4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine (PubChem CID 59213363) has the molecular formula C17H19N7
and a molecular weight of 321.39 g/mol. Its IUPAC name is 4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine |
| PubChem CID | 59213363 |
| Molecular Formula | C17H19N7 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine |
| SMILES | Nc1nccc(Nc2nc(N3CCCCC3)nc3ccccc23)n1 |
| InChI | InChI=1S/C17H19N7/c18-16-19-9-8-14(22-16)21-15-12-6-2-3-7-13(12)20-17(23-15)24-10-4-1-5-11-24/h2-3,6-9H,1,4-5,10-11H2,(H3,18,19,20,21,22,23) |
| InChIKey | NSZDDXPHODLUOM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine?
The IUPAC name of 4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine (CID 59213363) is 4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine.
What is the SMILES notation for 4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine?
The canonical SMILES for 4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine is Nc1nccc(Nc2nc(N3CCCCC3)nc3ccccc23)n1.
What is the InChIKey of 4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine?
The InChIKey is NSZDDXPHODLUOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N7/c18-16-19-9-8-14(22-16)21-15-12-6-2-3-7-13(12)20-17(23-15)24-10-4-1-5-11-24/h2-3,6-9H,1,4-5,10-11H2,(H3,18,19,20,21,22,23).
What are the key properties of 4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine?
4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine has a molecular weight of 321.39 g/mol, XLogP of 2.74, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(2-piperidin-1-ylquinazolin-4-yl)pyrimidine-2,4-diamine is sourced from PubChem (CID 59213363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).