C26H28FNO2 — CID 59214724
3-[2-(4-fluorophenyl)-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydroindol-1-yl]benzoic acid (PubChem CID 59214724) has the molecular formula C26H28FNO2 and a molecular weight of 405.51 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydroindol-1-yl]benzoic acid.
| Compound Name | 3-[2-(4-fluorophenyl)-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydroindol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 59214724 |
| Molecular Formula | C26H28FNO2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 3-[2-(4-fluorophenyl)-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydroindol-1-yl]benzoic acid |
| SMILES | CCC(C)(C)C1CCc2c(cc(-c3ccc(F)cc3)n2-c2cccc(C(=O)O)c2)C1 |
| InChI | InChI=1S/C26H28FNO2/c1-4-26(2,3)20-10-13-23-19(14-20)16-24(17-8-11-21(27)12-9-17)28(23)22-7-5-6-18(15-22)25(29)30/h5-9,11-12,15-16,20H,4,10,13-14H2,1-3H3,(H,29,30) |
| InChIKey | WQCPMHWVFZBJLM-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|