C20H25NO4 — CID 59214803
methyl (4aS,8aR,10aR)-3-isocyano-1,1,4a-trimethyl-2,6-dioxo-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-8a-carboxylate (PubChem CID 59214803) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is methyl (4aS,8aR,10aR)-3-isocyano-1,1,4a-trimethyl-2,6-dioxo-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-8a-carboxylate.
| Compound Name | methyl (4aS,8aR,10aR)-3-isocyano-1,1,4a-trimethyl-2,6-dioxo-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-8a-carboxylate |
|---|---|
| PubChem CID | 59214803 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | methyl (4aS,8aR,10aR)-3-isocyano-1,1,4a-trimethyl-2,6-dioxo-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-8a-carboxylate |
| SMILES | [C-]#[N+]C1C[C@]2(C)C3=CC(=O)CC[C@]3(C(=O)OC)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C20H25NO4/c1-18(2)14-7-9-20(17(24)25-5)8-6-12(22)10-15(20)19(14,3)11-13(21-4)16(18)23/h10,13-14H,6-9,11H2,1-3,5H3/t13?,14-,19-,20-/m0/s1 |
| InChIKey | WMUMGGTZEZEAFF-HQUBYHCZSA-N |
| XLogP | 3.14 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|