C24H40O3Si — CID 59214810
(4aS,8aR,10S,10aR)-10-[tert-butyl(dimethyl)silyl]oxy-1,1,4a,8a-tetramethyl-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione (PubChem CID 59214810) has the molecular formula C24H40O3Si and a molecular weight of 404.67 g/mol. Its IUPAC name is (4aS,8aR,10S,10aR)-10-[tert-butyl(dimethyl)silyl]oxy-1,1,4a,8a-tetramethyl-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione.
| Compound Name | (4aS,8aR,10S,10aR)-10-[tert-butyl(dimethyl)silyl]oxy-1,1,4a,8a-tetramethyl-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione |
|---|---|
| PubChem CID | 59214810 |
| Molecular Formula | C24H40O3Si |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | (4aS,8aR,10S,10aR)-10-[tert-butyl(dimethyl)silyl]oxy-1,1,4a,8a-tetramethyl-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione |
| SMILES | CC1(C)C(=O)CC[C@]2(C)C3=CC(=O)CC[C@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C24H40O3Si/c1-21(2,3)28(8,9)27-17-15-23(6)12-10-16(25)14-18(23)24(7)13-11-19(26)22(4,5)20(17)24/h14,17,20H,10-13,15H2,1-9H3/t17-,20-,23+,24+/m0/s1 |
| InChIKey | CQGBJXSBBVMNIF-XKRLJTCWSA-N |
| XLogP | 6.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|