3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid

C15H11FN2O4 — CID 59215232

IUPAC3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid
SMILESN/C(=N\OC(=O)c1ccccc1F)c1cccc(C(=O)O)c1
InChIInChI=1S/C15H11FN2O4/c16-12-7-2-1-6-11(12)15(21)22-18-13(17)9-4-3-5-10(8-9)14(19)20/h1-8H,(H2,17,18)(H,19,20)
InChIKeyVSKBIBFGOCAOME-UHFFFAOYSA-N
MW302.26 g/mol
LogP2.00
Rot. Bonds4

About 3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid

3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid (PubChem CID 59215232) has the molecular formula C15H11FN2O4 and a molecular weight of 302.26 g/mol. Its IUPAC name is 3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid.

Molecular Properties

Compound Name3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid
PubChem CID59215232
Molecular FormulaC15H11FN2O4
Molecular Weight302.26 g/mol
Exact Mass302.07
IUPAC Name3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid
SMILESN/C(=N\OC(=O)c1ccccc1F)c1cccc(C(=O)O)c1
InChIInChI=1S/C15H11FN2O4/c16-12-7-2-1-6-11(12)15(21)22-18-13(17)9-4-3-5-10(8-9)14(19)20/h1-8H,(H2,17,18)(H,19,20)
InChIKeyVSKBIBFGOCAOME-UHFFFAOYSA-N
XLogP2.00
TPSA101.98 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.26
LogP ≤ 52.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid?
The IUPAC name of 3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid (CID 59215232) is 3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid.
What is the SMILES notation for 3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid?
The canonical SMILES for 3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid is N/C(=N\OC(=O)c1ccccc1F)c1cccc(C(=O)O)c1.
What is the InChIKey of 3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid?
The InChIKey is VSKBIBFGOCAOME-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11FN2O4/c16-12-7-2-1-6-11(12)15(21)22-18-13(17)9-4-3-5-10(8-9)14(19)20/h1-8H,(H2,17,18)(H,19,20).
What are the key properties of 3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid?
3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid has a molecular weight of 302.26 g/mol, XLogP of 2.00, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid is sourced from PubChem (CID 59215232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).