About (6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium
(6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium (PubChem CID 59215243) has the molecular formula C9H9O2Y-
and a molecular weight of 238.07 g/mol. Its IUPAC name is (6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium.
Molecular Properties
| Compound Name | (6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium |
| PubChem CID | 59215243 |
| Molecular Formula | C9H9O2Y- |
| Molecular Weight | 238.07 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | (6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium |
| SMILES | CC1=C(C)C(=O)/C(=C\O)C=[C-]1.[Y] |
| InChI | InChI=1S/C9H9O2.Y/c1-6-3-4-8(5-10)9(11)7(6)2;/h4-5,10H,1-2H3;/q-1;/b8-5-; |
| InChIKey | DSPIBBVBORNYGU-HGKIGUAWSA-N |
| XLogP | 1.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.07 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium?
The IUPAC name of (6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium (CID 59215243) is (6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium.
What is the SMILES notation for (6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium?
The canonical SMILES for (6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium is CC1=C(C)C(=O)/C(=C\O)C=[C-]1.[Y].
What is the InChIKey of (6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium?
The InChIKey is DSPIBBVBORNYGU-HGKIGUAWSA-N. The full InChI is InChI=1S/C9H9O2.Y/c1-6-3-4-8(5-10)9(11)7(6)2;/h4-5,10H,1-2H3;/q-1;/b8-5-;.
What are the key properties of (6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium?
(6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium has a molecular weight of 238.07 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-6-(hydroxymethylidene)-2,3-dimethylcyclohexa-2,4-dien-1-one;yttrium is sourced from PubChem (CID 59215243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).