C19H36O6 — CID 59215332
(2R,3S,4R,5S,6S,8R,10R,11S,12S)-3,5,11,13-tetrahydroxy-2,4,6,8,10,12-hexamethyl-9-oxotridecanal (PubChem CID 59215332) has the molecular formula C19H36O6 and a molecular weight of 360.49 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S,8R,10R,11S,12S)-3,5,11,13-tetrahydroxy-2,4,6,8,10,12-hexamethyl-9-oxotridecanal.
| Compound Name | (2R,3S,4R,5S,6S,8R,10R,11S,12S)-3,5,11,13-tetrahydroxy-2,4,6,8,10,12-hexamethyl-9-oxotridecanal |
|---|---|
| PubChem CID | 59215332 |
| Molecular Formula | C19H36O6 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (2R,3S,4R,5S,6S,8R,10R,11S,12S)-3,5,11,13-tetrahydroxy-2,4,6,8,10,12-hexamethyl-9-oxotridecanal |
| SMILES | CC(C=O)[C@@H](O)[C@H](C)[C@@H](O)[C@@H](C)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CO |
| InChI | InChI=1S/C19H36O6/c1-10(16(22)14(5)18(24)12(3)8-20)7-11(2)17(23)15(6)19(25)13(4)9-21/h8,10-16,18-19,21-22,24-25H,7,9H2,1-6H3/t10-,11+,12?,13-,14+,15-,16-,18+,19-/m0/s1 |
| InChIKey | SROYNRRCGXBGHW-CJTGJYOLSA-N |
| XLogP | 1.04 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|