C9H14O4S — CID 59215500
1,2,7-trimethyl-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide (PubChem CID 59215500) has the molecular formula C9H14O4S and a molecular weight of 218.27 g/mol. Its IUPAC name is 1,2,7-trimethyl-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide.
| Compound Name | 1,2,7-trimethyl-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide |
|---|---|
| PubChem CID | 59215500 |
| Molecular Formula | C9H14O4S |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 1,2,7-trimethyl-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide |
| SMILES | CC1C2OS(=O)(=O)C3CC1(C)OC23C |
| InChI | InChI=1S/C9H14O4S/c1-5-7-9(3)6(14(10,11)12-7)4-8(5,2)13-9/h5-7H,4H2,1-3H3 |
| InChIKey | VMENYRGLNFOGFS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|