About 2-Methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile
2-Methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile (PubChem CID 59215509) has the molecular formula C9H11NO3S
and a molecular weight of 213.26 g/mol. Its IUPAC name is 2-methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile.
Molecular Properties
| Compound Name | 2-Methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile |
| PubChem CID | 59215509 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 2-methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile |
| SMILES | CC1C2CC3C1OS(=O)(=O)C3(C2)C#N |
| InChI | InChI=1S/C9H11NO3S/c1-5-6-2-7-8(5)13-14(11,12)9(7,3-6)4-10/h5-8H,2-3H2,1H3 |
| InChIKey | GUWMHBJIKIMLQZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | 442 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-Methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile?
The IUPAC name of 2-Methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile (CID 59215509) is 2-methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile.
What is the SMILES notation for 2-Methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile?
The canonical SMILES for 2-Methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile is CC1C2CC3C1OS(=O)(=O)C3(C2)C#N.
What is the InChIKey of 2-Methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile?
The InChIKey is GUWMHBJIKIMLQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3S/c1-5-6-2-7-8(5)13-14(11,12)9(7,3-6)4-10/h5-8H,2-3H2,1H3.
What are the key properties of 2-Methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile?
2-Methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile has a molecular weight of 213.26 g/mol, XLogP of 0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Methyl-5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile is sourced from PubChem (CID 59215509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).