C16H29N3O5 — CID 59215681
tert-butyl N-[(E)-N-methyl-N'-[(2-methylpropan-2-yl)oxycarbonyl]-N-(3-oxobutyl)carbamimidoyl]carbamate (PubChem CID 59215681) has the molecular formula C16H29N3O5 and a molecular weight of 343.42 g/mol. Its IUPAC name is tert-butyl N-[(E)-N-methyl-N'-[(2-methylpropan-2-yl)oxycarbonyl]-N-(3-oxobutyl)carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[(E)-N-methyl-N'-[(2-methylpropan-2-yl)oxycarbonyl]-N-(3-oxobutyl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 59215681 |
| Molecular Formula | C16H29N3O5 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | tert-butyl N-[(E)-N-methyl-N'-[(2-methylpropan-2-yl)oxycarbonyl]-N-(3-oxobutyl)carbamimidoyl]carbamate |
| SMILES | CC(=O)CCN(C)/C(=N/C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29N3O5/c1-11(20)9-10-19(8)12(17-13(21)23-15(2,3)4)18-14(22)24-16(5,6)7/h9-10H2,1-8H3,(H,17,18,21,22) |
| InChIKey | NRQBNNGWRXYZPT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|