C8H16N2O3S — CID 59215777
[(7S)-2,2-dioxo-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]thiazin-7-yl]methanol (PubChem CID 59215777) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is [(7S)-2,2-dioxo-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]thiazin-7-yl]methanol.
| Compound Name | [(7S)-2,2-dioxo-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]thiazin-7-yl]methanol |
|---|---|
| PubChem CID | 59215777 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | [(7S)-2,2-dioxo-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]thiazin-7-yl]methanol |
| SMILES | O=S1(=O)CCN2C[C@@H](CO)NCC2C1 |
| InChI | InChI=1S/C8H16N2O3S/c11-5-7-4-10-1-2-14(12,13)6-8(10)3-9-7/h7-9,11H,1-6H2/t7-,8?/m0/s1 |
| InChIKey | HXQOJSREEGVBIN-JAMMHHFISA-N |
| XLogP | -1.95 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |