C7H10F2N2O — CID 59215882
7,7-difluoro-1,2,3,4,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 59215882) has the molecular formula C7H10F2N2O and a molecular weight of 176.17 g/mol. Its IUPAC name is 7,7-difluoro-1,2,3,4,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 7,7-difluoro-1,2,3,4,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 59215882 |
| Molecular Formula | C7H10F2N2O |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 7,7-difluoro-1,2,3,4,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | O=C1N2CCNCC2CC1(F)F |
| InChI | InChI=1S/C7H10F2N2O/c8-7(9)3-5-4-10-1-2-11(5)6(7)12/h5,10H,1-4H2 |
| InChIKey | QPLVLFGFWZWRGG-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |