C23H15N7 — CID 59216341
6-[1-[6-(4-isocyanophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]cyclopropyl]quinoline (PubChem CID 59216341) has the molecular formula C23H15N7 and a molecular weight of 389.42 g/mol. Its IUPAC name is 6-[1-[6-(4-isocyanophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]cyclopropyl]quinoline.
| Compound Name | 6-[1-[6-(4-isocyanophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]cyclopropyl]quinoline |
|---|---|
| PubChem CID | 59216341 |
| Molecular Formula | C23H15N7 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 6-[1-[6-(4-isocyanophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]cyclopropyl]quinoline |
| SMILES | [C-]#[N+]c1ccc(-c2cnc3nnc(C4(c5ccc6ncccc6c5)CC4)n3n2)cc1 |
| InChI | InChI=1S/C23H15N7/c1-24-18-7-4-15(5-8-18)20-14-26-22-28-27-21(30(22)29-20)23(10-11-23)17-6-9-19-16(13-17)3-2-12-25-19/h2-9,12-14H,10-11H2 |
| InChIKey | FPHHFCVKHAZOKK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 73.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|