C31H35N5O6Si — CID 59216656
4-[4-[(4R)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxo-1-(2-trimethylsilylethoxymethyl)imidazolidin-4-yl]phenyl]pyridine-2-carboxamide (PubChem CID 59216656) has the molecular formula C31H35N5O6Si and a molecular weight of 601.74 g/mol. Its IUPAC name is 4-[4-[(4R)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxo-1-(2-trimethylsilylethoxymethyl)imidazolidin-4-yl]phenyl]pyridine-2-carboxamide.
| Compound Name | 4-[4-[(4R)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxo-1-(2-trimethylsilylethoxymethyl)imidazolidin-4-yl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59216656 |
| Molecular Formula | C31H35N5O6Si |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | 4-[4-[(4R)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxo-1-(2-trimethylsilylethoxymethyl)imidazolidin-4-yl]phenyl]pyridine-2-carboxamide |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(c3ccc(-c4ccnc(C(N)=O)c4)cc3)NC(=O)N(COCC[Si](C)(C)C)C1=O)C2 |
| InChI | InChI=1S/C31H35N5O6Si/c1-41-24-10-7-22-17-35(28(38)25(22)16-24)18-31(29(39)36(30(40)34-31)19-42-13-14-43(2,3)4)23-8-5-20(6-9-23)21-11-12-33-26(15-21)27(32)37/h5-12,15-16H,13-14,17-19H2,1-4H3,(H2,32,37)(H,34,40)/t31-/m0/s1 |
| InChIKey | CCFCUNZESRJOES-HKBQPEDESA-N |
| XLogP | 3.57 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|