About 6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran
6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran (PubChem CID 59216878) has the molecular formula C24H27O5P
and a molecular weight of 426.45 g/mol. Its IUPAC name is 6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran.
Molecular Properties
| Compound Name | 6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran |
| PubChem CID | 59216878 |
| Molecular Formula | C24H27O5P |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran |
| SMILES | CCOP(=O)(OCC)c1cc2c(c(C)c1-c1c(OC)ccc3ccccc13)COC2 |
| InChI | InChI=1S/C24H27O5P/c1-5-28-30(25,29-6-2)22-13-18-14-27-15-20(18)16(3)23(22)24-19-10-8-7-9-17(19)11-12-21(24)26-4/h7-13H,5-6,14-15H2,1-4H3 |
| InChIKey | GXDJHGZHBKSJTN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran?
The IUPAC name of 6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran (CID 59216878) is 6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran.
What is the SMILES notation for 6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran?
The canonical SMILES for 6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran is CCOP(=O)(OCC)c1cc2c(c(C)c1-c1c(OC)ccc3ccccc13)COC2.
What is the InChIKey of 6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran?
The InChIKey is GXDJHGZHBKSJTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27O5P/c1-5-28-30(25,29-6-2)22-13-18-14-27-15-20(18)16(3)23(22)24-19-10-8-7-9-17(19)11-12-21(24)26-4/h7-13H,5-6,14-15H2,1-4H3.
What are the key properties of 6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran?
6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran has a molecular weight of 426.45 g/mol, XLogP of 5.75, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-diethoxyphosphoryl-5-(2-methoxynaphthalen-1-yl)-4-methyl-1,3-dihydro-2-benzofuran is sourced from PubChem (CID 59216878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).