C36H26N4O2 — CID 59217384
14,32-diethyl-4,14,22,32-tetrazanonacyclo[19.15.0.03,19.05,17.07,15.08,13.023,35.025,33.026,31]hexatriaconta-1,3(19),5(17),6,8,10,12,15,20,23(35),24,26,28,30,33-pentadecaene-18,36-dione (PubChem CID 59217384) has the molecular formula C36H26N4O2 and a molecular weight of 546.63 g/mol. Its IUPAC name is 14,32-diethyl-4,14,22,32-tetrazanonacyclo[19.15.0.03,19.05,17.07,15.08,13.023,35.025,33.026,31]hexatriaconta-1,3(19),5(17),6,8,10,12,15,20,23(35),24,26,28,30,33-pentadecaene-18,36-dione.
| Compound Name | 14,32-diethyl-4,14,22,32-tetrazanonacyclo[19.15.0.03,19.05,17.07,15.08,13.023,35.025,33.026,31]hexatriaconta-1,3(19),5(17),6,8,10,12,15,20,23(35),24,26,28,30,33-pentadecaene-18,36-dione |
|---|---|
| PubChem CID | 59217384 |
| Molecular Formula | C36H26N4O2 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 14,32-diethyl-4,14,22,32-tetrazanonacyclo[19.15.0.03,19.05,17.07,15.08,13.023,35.025,33.026,31]hexatriaconta-1,3(19),5(17),6,8,10,12,15,20,23(35),24,26,28,30,33-pentadecaene-18,36-dione |
| SMILES | CCn1c2ccccc2c2cc3[nH]c4cc5c(=O)c6cc7c(cc6[nH]c5cc4c(=O)c3cc21)c1ccccc1n7CC |
| InChI | InChI=1S/C36H26N4O2/c1-3-39-31-11-7-5-9-19(31)21-13-27-25(17-33(21)39)35(41)23-15-30-24(16-29(23)37-27)36(42)26-18-34-22(14-28(26)38-30)20-10-6-8-12-32(20)40(34)4-2/h5-18H,3-4H2,1-2H3,(H,37,41)(H,38,42) |
| InChIKey | OBIXHDPCNNJITM-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 75.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|