About N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide
N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide (PubChem CID 59217984) has the molecular formula C9H12N2OS
and a molecular weight of 196.28 g/mol. Its IUPAC name is N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide |
| PubChem CID | 59217984 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide |
| SMILES | C/C=C\c1cnc(C(=O)N(C)C)s1 |
| InChI | InChI=1S/C9H12N2OS/c1-4-5-7-6-10-8(13-7)9(12)11(2)3/h4-6H,1-3H3/b5-4- |
| InChIKey | SDJYWDGLSHMLPU-PLNGDYQASA-N |
| XLogP | 1.88 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide?
The IUPAC name of N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide (CID 59217984) is N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide?
The canonical SMILES for N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide is C/C=C\c1cnc(C(=O)N(C)C)s1.
What is the InChIKey of N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide?
The InChIKey is SDJYWDGLSHMLPU-PLNGDYQASA-N. The full InChI is InChI=1S/C9H12N2OS/c1-4-5-7-6-10-8(13-7)9(12)11(2)3/h4-6H,1-3H3/b5-4-.
What are the key properties of N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide?
N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide has a molecular weight of 196.28 g/mol, XLogP of 1.88, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 59217984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).