About 5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide
5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide (PubChem CID 59218000) has the molecular formula C7H8N2OS
and a molecular weight of 168.22 g/mol. Its IUPAC name is 5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide |
| PubChem CID | 59218000 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide |
| SMILES | C/C=C\c1cnc(C(N)=O)s1 |
| InChI | InChI=1S/C7H8N2OS/c1-2-3-5-4-9-7(11-5)6(8)10/h2-4H,1H3,(H2,8,10)/b3-2- |
| InChIKey | LUNQGRRRCPWDGC-IHWYPQMZSA-N |
| XLogP | 1.28 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide?
The IUPAC name of 5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide (CID 59218000) is 5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide?
The canonical SMILES for 5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide is C/C=C\c1cnc(C(N)=O)s1.
What is the InChIKey of 5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide?
The InChIKey is LUNQGRRRCPWDGC-IHWYPQMZSA-N. The full InChI is InChI=1S/C7H8N2OS/c1-2-3-5-4-9-7(11-5)6(8)10/h2-4H,1H3,(H2,8,10)/b3-2-.
What are the key properties of 5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide?
5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide has a molecular weight of 168.22 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-prop-1-enyl]-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 59218000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).