C34H49N3O6 — CID 59218155
3-[(2S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethyl-1-morpholin-4-ylpropan-1-one (PubChem CID 59218155) has the molecular formula C34H49N3O6 and a molecular weight of 595.78 g/mol. Its IUPAC name is 3-[(2S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethyl-1-morpholin-4-ylpropan-1-one.
| Compound Name | 3-[(2S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethyl-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 59218155 |
| Molecular Formula | C34H49N3O6 |
| Molecular Weight | 595.78 g/mol |
| Exact Mass | 595.36 |
| IUPAC Name | 3-[(2S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethyl-1-morpholin-4-ylpropan-1-one |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN[C@H](CC(C)(C)C(=O)N4CCOCC4)C[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C34H49N3O6/c1-34(2,33(38)37-13-17-41-18-14-37)22-27-21-29(26-7-9-28(40-4)10-8-26)32(23-35-27)43-24-25-6-11-31-30(20-25)36(15-19-42-31)12-5-16-39-3/h6-11,20,27,29,32,35H,5,12-19,21-24H2,1-4H3/t27-,29+,32-/m0/s1 |
| InChIKey | IEOOJMADXLXRLY-UMZKNKDHSA-N |
| XLogP | 4.24 |
| TPSA | 81.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.78 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|