C24H32F3N6O3+ — CID 59218282
N-[(1R,2S,5R)-2-[(3S)-3-[[1-hydroxy-6-(trifluoromethyl)quinazolin-1-ium-4-yl]amino]-2-oxopyrrolidin-1-yl]-5-(propan-2-ylamino)cyclohexyl]acetamide (PubChem CID 59218282) has the molecular formula C24H32F3N6O3+ and a molecular weight of 509.55 g/mol. Its IUPAC name is N-[(1R,2S,5R)-2-[(3S)-3-[[1-hydroxy-6-(trifluoromethyl)quinazolin-1-ium-4-yl]amino]-2-oxopyrrolidin-1-yl]-5-(propan-2-ylamino)cyclohexyl]acetamide.
| Compound Name | N-[(1R,2S,5R)-2-[(3S)-3-[[1-hydroxy-6-(trifluoromethyl)quinazolin-1-ium-4-yl]amino]-2-oxopyrrolidin-1-yl]-5-(propan-2-ylamino)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 59218282 |
| Molecular Formula | C24H32F3N6O3+ |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | N-[(1R,2S,5R)-2-[(3S)-3-[[1-hydroxy-6-(trifluoromethyl)quinazolin-1-ium-4-yl]amino]-2-oxopyrrolidin-1-yl]-5-(propan-2-ylamino)cyclohexyl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@H](NC(C)C)CC[C@@H]1N1CC[C@H](Nc2nc[n+](O)c3ccc(C(F)(F)F)cc23)C1=O |
| InChI | InChI=1S/C24H31F3N6O3/c1-13(2)29-16-5-7-21(19(11-16)30-14(3)34)32-9-8-18(23(32)35)31-22-17-10-15(24(25,26)27)4-6-20(17)33(36)12-28-22/h4,6,10,12-13,16,18-19,21,29,36H,5,7-9,11H2,1-3H3,(H,30,34)/p+1/t16-,18+,19-,21+/m1/s1 |
| InChIKey | CKNSXFXSOALXBL-LYSIVYOWSA-O |
| XLogP | 2.21 |
| TPSA | 110.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|