C12H14N2O2 — CID 59218286
benzyl N-(2-cyano-1,1,1,3,3,3-hexadeuteriopropan-2-yl)carbamate (PubChem CID 59218286) has the molecular formula C12H14N2O2 and a molecular weight of 224.29 g/mol. Its IUPAC name is benzyl N-(2-cyano-1,1,1,3,3,3-hexadeuteriopropan-2-yl)carbamate.
| Compound Name | benzyl N-(2-cyano-1,1,1,3,3,3-hexadeuteriopropan-2-yl)carbamate |
|---|---|
| PubChem CID | 59218286 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | benzyl N-(2-cyano-1,1,1,3,3,3-hexadeuteriopropan-2-yl)carbamate |
| SMILES | [2H]C([2H])([2H])C(C#N)(NC(=O)OCc1ccccc1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C12H14N2O2/c1-12(2,9-13)14-11(15)16-8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3,(H,14,15)/i1D3,2D3 |
| InChIKey | DJQKBMUYZUEUBU-WFGJKAKNSA-N |
| XLogP | 2.21 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |