C16H21BrO2 — CID 59218386
2-[(1-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)methoxy]oxane (PubChem CID 59218386) has the molecular formula C16H21BrO2 and a molecular weight of 325.25 g/mol. Its IUPAC name is 2-[(1-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)methoxy]oxane.
| Compound Name | 2-[(1-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)methoxy]oxane |
|---|---|
| PubChem CID | 59218386 |
| Molecular Formula | C16H21BrO2 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-[(1-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)methoxy]oxane |
| SMILES | Brc1c(COC2CCCCO2)ccc2c1CCCC2 |
| InChI | InChI=1S/C16H21BrO2/c17-16-13(11-19-15-7-3-4-10-18-15)9-8-12-5-1-2-6-14(12)16/h8-9,15H,1-7,10-11H2 |
| InChIKey | JQXAKWFKRBGDEC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |