About (1-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)methanol
(1-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)methanol (PubChem CID 59218412) has the molecular formula C11H13FO
and a molecular weight of 180.22 g/mol. Its IUPAC name is (1-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)methanol.
Analyze (1-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)methanol?
The IUPAC name of (1-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)methanol (CID 59218412) is (1-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)methanol.
What is the SMILES notation for (1-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)methanol?
The canonical SMILES for (1-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)methanol is OCc1ccc2c(c1F)CCCC2.
What is the InChIKey of (1-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)methanol?
The InChIKey is LTQTTWLGDPRMMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO/c12-11-9(7-13)6-5-8-3-1-2-4-10(8)11/h5-6,13H,1-4,7H2.
What are the key properties of (1-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)methanol?
(1-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)methanol has a molecular weight of 180.22 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)methanol is sourced from PubChem (CID 59218412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).