methyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate

C14H15NO3 — CID 59218547

IUPACmethyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate
SMILESCOC(=O)C[C@H](c1ccc(O)cc1)n1cccc1
InChIInChI=1S/C14H15NO3/c1-18-14(17)10-13(15-8-2-3-9-15)11-4-6-12(16)7-5-11/h2-9,13,16H,10H2,1H3/t13-/m1/s1
InChIKeyBGNBKGLFHHDJGG-CYBMUJFWSA-N
MW245.28 g/mol
LogP2.35
Rot. Bonds4

About methyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate

methyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate (PubChem CID 59218547) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is methyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate.

Molecular Properties

Compound Namemethyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate
PubChem CID59218547
Molecular FormulaC14H15NO3
Molecular Weight245.28 g/mol
Exact Mass245.11
IUPAC Namemethyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate
SMILESCOC(=O)C[C@H](c1ccc(O)cc1)n1cccc1
InChIInChI=1S/C14H15NO3/c1-18-14(17)10-13(15-8-2-3-9-15)11-4-6-12(16)7-5-11/h2-9,13,16H,10H2,1H3/t13-/m1/s1
InChIKeyBGNBKGLFHHDJGG-CYBMUJFWSA-N
XLogP2.35
TPSA51.46 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.28
LogP ≤ 52.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate?
The IUPAC name of methyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate (CID 59218547) is methyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate.
What is the SMILES notation for methyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate?
The canonical SMILES for methyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate is COC(=O)C[C@H](c1ccc(O)cc1)n1cccc1.
What is the InChIKey of methyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate?
The InChIKey is BGNBKGLFHHDJGG-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H15NO3/c1-18-14(17)10-13(15-8-2-3-9-15)11-4-6-12(16)7-5-11/h2-9,13,16H,10H2,1H3/t13-/m1/s1.
What are the key properties of methyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate?
methyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate has a molecular weight of 245.28 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R)-3-(4-hydroxyphenyl)-3-pyrrol-1-ylpropanoate is sourced from PubChem (CID 59218547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).