C31H33F6N5O4 — CID 59218759
tert-butyl (2S)-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[[2-(pyridin-4-ylmethylamino)pyridine-3-carbonyl]amino]phenyl]propan-2-yl]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 59218759) has the molecular formula C31H33F6N5O4 and a molecular weight of 653.62 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[[2-(pyridin-4-ylmethylamino)pyridine-3-carbonyl]amino]phenyl]propan-2-yl]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[[2-(pyridin-4-ylmethylamino)pyridine-3-carbonyl]amino]phenyl]propan-2-yl]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59218759 |
| Molecular Formula | C31H33F6N5O4 |
| Molecular Weight | 653.62 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | tert-butyl (2S)-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[[2-(pyridin-4-ylmethylamino)pyridine-3-carbonyl]amino]phenyl]propan-2-yl]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1COC(c1ccc(NC(=O)c2cccnc2NCc2ccncc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C31H33F6N5O4/c1-28(2,3)46-27(44)42-17-5-6-23(42)19-45-29(30(32,33)34,31(35,36)37)21-8-10-22(11-9-21)41-26(43)24-7-4-14-39-25(24)40-18-20-12-15-38-16-13-20/h4,7-16,23H,5-6,17-19H2,1-3H3,(H,39,40)(H,41,43)/t23-/m0/s1 |
| InChIKey | MBCJVNKPKWNJRF-QHCPKHFHSA-N |
| XLogP | 7.08 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.62 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |