C25H30F3O3P — CID 59218779
[(4,4,4-trifluoro-2-methylbutyl)-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 59218779) has the molecular formula C25H30F3O3P and a molecular weight of 466.48 g/mol. Its IUPAC name is [(4,4,4-trifluoro-2-methylbutyl)-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [(4,4,4-trifluoro-2-methylbutyl)-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 59218779 |
| Molecular Formula | C25H30F3O3P |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | [(4,4,4-trifluoro-2-methylbutyl)-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(CC(C)CC(F)(F)F)C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C25H30F3O3P/c1-14-8-17(4)21(18(5)9-14)23(29)32(31,13-16(3)12-25(26,27)28)24(30)22-19(6)10-15(2)11-20(22)7/h8-11,16H,12-13H2,1-7H3 |
| InChIKey | LFRGBYGNSUCNJC-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|